C14H20BrN3O2S — CID 9220400
1-[[2-(3-bromophenoxy)acetyl]amino]-3-pentylthiourea (PubChem CID 9220400) has the molecular formula C14H20BrN3O2S and a molecular weight of 374.30 g/mol. Its IUPAC name is 1-[[2-(3-bromophenoxy)acetyl]amino]-3-pentylthiourea.
| Compound Name | 1-[[2-(3-bromophenoxy)acetyl]amino]-3-pentylthiourea |
|---|---|
| PubChem CID | 9220400 |
| Molecular Formula | C14H20BrN3O2S |
| Molecular Weight | 374.30 g/mol |
| Exact Mass | 373.05 |
| IUPAC Name | 1-[[2-(3-bromophenoxy)acetyl]amino]-3-pentylthiourea |
| SMILES | CCCCCNC(=S)NNC(=O)COc1cccc(Br)c1 |
| InChI | InChI=1S/C14H20BrN3O2S/c1-2-3-4-8-16-14(21)18-17-13(19)10-20-12-7-5-6-11(15)9-12/h5-7,9H,2-4,8,10H2,1H3,(H,17,19)(H2,16,18,21) |
| InChIKey | DDULKTWTOHWWRR-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.30 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|