C16H24BrN3O2S — CID 9220419
1-[4-(4-bromophenoxy)butanoylamino]-3-pentylthiourea (PubChem CID 9220419) has the molecular formula C16H24BrN3O2S and a molecular weight of 402.36 g/mol. Its IUPAC name is 1-[4-(4-bromophenoxy)butanoylamino]-3-pentylthiourea.
| Compound Name | 1-[4-(4-bromophenoxy)butanoylamino]-3-pentylthiourea |
|---|---|
| PubChem CID | 9220419 |
| Molecular Formula | C16H24BrN3O2S |
| Molecular Weight | 402.36 g/mol |
| Exact Mass | 401.08 |
| IUPAC Name | 1-[4-(4-bromophenoxy)butanoylamino]-3-pentylthiourea |
| SMILES | CCCCCNC(=S)NNC(=O)CCCOc1ccc(Br)cc1 |
| InChI | InChI=1S/C16H24BrN3O2S/c1-2-3-4-11-18-16(23)20-19-15(21)6-5-12-22-14-9-7-13(17)8-10-14/h7-10H,2-6,11-12H2,1H3,(H,19,21)(H2,18,20,23) |
| InChIKey | KTSHMHGXXYYFDW-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.36 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|