C25H43N3O5 — CID 70179783
1-(6-decan-5-yloxyhexanoylamino)-3-[2-(4-hydroxyphenoxy)ethyl]urea (PubChem CID 70179783) has the molecular formula C25H43N3O5 and a molecular weight of 465.64 g/mol. Its IUPAC name is 1-(6-decan-5-yloxyhexanoylamino)-3-[2-(4-hydroxyphenoxy)ethyl]urea.
| Compound Name | 1-(6-decan-5-yloxyhexanoylamino)-3-[2-(4-hydroxyphenoxy)ethyl]urea |
|---|---|
| PubChem CID | 70179783 |
| Molecular Formula | C25H43N3O5 |
| Molecular Weight | 465.64 g/mol |
| Exact Mass | 465.32 |
| IUPAC Name | 1-(6-decan-5-yloxyhexanoylamino)-3-[2-(4-hydroxyphenoxy)ethyl]urea |
| SMILES | CCCCCC(CCCC)OCCCCCC(=O)NNC(=O)NCCOc1ccc(O)cc1 |
| InChI | InChI=1S/C25H43N3O5/c1-3-5-8-12-22(11-6-4-2)32-19-10-7-9-13-24(30)27-28-25(31)26-18-20-33-23-16-14-21(29)15-17-23/h14-17,22,29H,3-13,18-20H2,1-2H3,(H,27,30)(H2,26,28,31) |
| InChIKey | OBUYUIIUCSSMNU-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 108.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.64 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|