C34H53N3O5 — CID 70019817
11-[2-[4-(4-hydroxyphenoxy)phenoxy]ethylcarbamoylamino]-N-methyloctadecanamide (PubChem CID 70019817) has the molecular formula C34H53N3O5 and a molecular weight of 583.81 g/mol. Its IUPAC name is 11-[2-[4-(4-hydroxyphenoxy)phenoxy]ethylcarbamoylamino]-N-methyloctadecanamide.
| Compound Name | 11-[2-[4-(4-hydroxyphenoxy)phenoxy]ethylcarbamoylamino]-N-methyloctadecanamide |
|---|---|
| PubChem CID | 70019817 |
| Molecular Formula | C34H53N3O5 |
| Molecular Weight | 583.81 g/mol |
| Exact Mass | 583.40 |
| IUPAC Name | 11-[2-[4-(4-hydroxyphenoxy)phenoxy]ethylcarbamoylamino]-N-methyloctadecanamide |
| SMILES | CCCCCCCC(CCCCCCCCCC(=O)NC)NC(=O)NCCOc1ccc(Oc2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C34H53N3O5/c1-3-4-5-9-12-15-28(16-13-10-7-6-8-11-14-17-33(39)35-2)37-34(40)36-26-27-41-30-22-24-32(25-23-30)42-31-20-18-29(38)19-21-31/h18-25,28,38H,3-17,26-27H2,1-2H3,(H,35,39)(H2,36,37,40) |
| InChIKey | ZIMRXVLEFLVBNK-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 108.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.81 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|