C32H49N3O4 — CID 70020028
11-[[4-(4-hydroxyphenoxy)phenyl]carbamoylamino]-N-methyloctadecanamide (PubChem CID 70020028) has the molecular formula C32H49N3O4 and a molecular weight of 539.76 g/mol. Its IUPAC name is 11-[[4-(4-hydroxyphenoxy)phenyl]carbamoylamino]-N-methyloctadecanamide.
| Compound Name | 11-[[4-(4-hydroxyphenoxy)phenyl]carbamoylamino]-N-methyloctadecanamide |
|---|---|
| PubChem CID | 70020028 |
| Molecular Formula | C32H49N3O4 |
| Molecular Weight | 539.76 g/mol |
| Exact Mass | 539.37 |
| IUPAC Name | 11-[[4-(4-hydroxyphenoxy)phenyl]carbamoylamino]-N-methyloctadecanamide |
| SMILES | CCCCCCCC(CCCCCCCCCC(=O)NC)NC(=O)Nc1ccc(Oc2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C32H49N3O4/c1-3-4-5-9-12-15-26(16-13-10-7-6-8-11-14-17-31(37)33-2)34-32(38)35-27-18-22-29(23-19-27)39-30-24-20-28(36)21-25-30/h18-26,36H,3-17H2,1-2H3,(H,33,37)(H2,34,35,38) |
| InChIKey | OFHUMWBZXJYPCV-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.76 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|