C28H50N2O4 — CID 18183865
3-(4-hydroxyphenoxy)-N-methylpropanamide;octadecanamide (PubChem CID 18183865) has the molecular formula C28H50N2O4 and a molecular weight of 478.72 g/mol. Its IUPAC name is 3-(4-hydroxyphenoxy)-N-methylpropanamide;octadecanamide.
| Compound Name | 3-(4-hydroxyphenoxy)-N-methylpropanamide;octadecanamide |
|---|---|
| PubChem CID | 18183865 |
| Molecular Formula | C28H50N2O4 |
| Molecular Weight | 478.72 g/mol |
| Exact Mass | 478.38 |
| IUPAC Name | 3-(4-hydroxyphenoxy)-N-methylpropanamide;octadecanamide |
| SMILES | CCCCCCCCCCCCCCCCCC(N)=O.CNC(=O)CCOc1ccc(O)cc1 |
| InChI | InChI=1S/C18H37NO.C10H13NO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-11-10(13)6-7-14-9-4-2-8(12)3-5-9/h2-17H2,1H3,(H2,19,20);2-5,12H,6-7H2,1H3,(H,11,13) |
| InChIKey | DVMNWJPZTLISIU-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.72 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|