C24H30O4 — CID 101496849
1-(4-decoxyphenyl)-2-(4-hydroxyphenyl)ethane-1,2-dione (PubChem CID 101496849) has the molecular formula C24H30O4 and a molecular weight of 382.50 g/mol. Its IUPAC name is 1-(4-decoxyphenyl)-2-(4-hydroxyphenyl)ethane-1,2-dione.
| Compound Name | 1-(4-decoxyphenyl)-2-(4-hydroxyphenyl)ethane-1,2-dione |
|---|---|
| PubChem CID | 101496849 |
| Molecular Formula | C24H30O4 |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | 1-(4-decoxyphenyl)-2-(4-hydroxyphenyl)ethane-1,2-dione |
| SMILES | CCCCCCCCCCOc1ccc(C(=O)C(=O)c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C24H30O4/c1-2-3-4-5-6-7-8-9-18-28-22-16-12-20(13-17-22)24(27)23(26)19-10-14-21(25)15-11-19/h10-17,25H,2-9,18H2,1H3 |
| InChIKey | SHVODVVWWUHKED-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|