C17H19N3O2S — CID 40632106
1-(2,3-dimethylphenyl)-3-[(2-phenoxyacetyl)amino]thiourea (PubChem CID 40632106) has the molecular formula C17H19N3O2S and a molecular weight of 329.43 g/mol. Its IUPAC name is 1-(2,3-dimethylphenyl)-3-[(2-phenoxyacetyl)amino]thiourea.
| Compound Name | 1-(2,3-dimethylphenyl)-3-[(2-phenoxyacetyl)amino]thiourea |
|---|---|
| PubChem CID | 40632106 |
| Molecular Formula | C17H19N3O2S |
| Molecular Weight | 329.43 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | 1-(2,3-dimethylphenyl)-3-[(2-phenoxyacetyl)amino]thiourea |
| SMILES | Cc1cccc(NC(=S)NNC(=O)COc2ccccc2)c1C |
| InChI | InChI=1S/C17H19N3O2S/c1-12-7-6-10-15(13(12)2)18-17(23)20-19-16(21)11-22-14-8-4-3-5-9-14/h3-10H,11H2,1-2H3,(H,19,21)(H2,18,20,23) |
| InChIKey | KKTWPGCRVRFBFQ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.43 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|