C20H25N3O2S — CID 7923396
1-[3-(2,5-dimethylphenoxy)propanoylamino]-3-(2,3-dimethylphenyl)thiourea (PubChem CID 7923396) has the molecular formula C20H25N3O2S and a molecular weight of 371.51 g/mol. Its IUPAC name is 1-[3-(2,5-dimethylphenoxy)propanoylamino]-3-(2,3-dimethylphenyl)thiourea.
| Compound Name | 1-[3-(2,5-dimethylphenoxy)propanoylamino]-3-(2,3-dimethylphenyl)thiourea |
|---|---|
| PubChem CID | 7923396 |
| Molecular Formula | C20H25N3O2S |
| Molecular Weight | 371.51 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | 1-[3-(2,5-dimethylphenoxy)propanoylamino]-3-(2,3-dimethylphenyl)thiourea |
| SMILES | Cc1ccc(C)c(OCCC(=O)NNC(=S)Nc2cccc(C)c2C)c1 |
| InChI | InChI=1S/C20H25N3O2S/c1-13-8-9-15(3)18(12-13)25-11-10-19(24)22-23-20(26)21-17-7-5-6-14(2)16(17)4/h5-9,12H,10-11H2,1-4H3,(H,22,24)(H2,21,23,26) |
| InChIKey | VBBIRVOQOREORC-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.51 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|