C20H25N3OS2 — CID 30871598
1-(2,3-dimethylphenyl)-3-[3-(3,4-dimethylphenyl)sulfanylpropanoylamino]thiourea (PubChem CID 30871598) has the molecular formula C20H25N3OS2 and a molecular weight of 387.57 g/mol. Its IUPAC name is 1-(2,3-dimethylphenyl)-3-[3-(3,4-dimethylphenyl)sulfanylpropanoylamino]thiourea.
| Compound Name | 1-(2,3-dimethylphenyl)-3-[3-(3,4-dimethylphenyl)sulfanylpropanoylamino]thiourea |
|---|---|
| PubChem CID | 30871598 |
| Molecular Formula | C20H25N3OS2 |
| Molecular Weight | 387.57 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | 1-(2,3-dimethylphenyl)-3-[3-(3,4-dimethylphenyl)sulfanylpropanoylamino]thiourea |
| SMILES | Cc1ccc(SCCC(=O)NNC(=S)Nc2cccc(C)c2C)cc1C |
| InChI | InChI=1S/C20H25N3OS2/c1-13-8-9-17(12-15(13)3)26-11-10-19(24)22-23-20(25)21-18-7-5-6-14(2)16(18)4/h5-9,12H,10-11H2,1-4H3,(H,22,24)(H2,21,23,25) |
| InChIKey | XIKDAGDMTKJUGI-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.57 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|