C16H25N3O2S2 — CID 8637676
1-[3-(3,4-dimethylphenyl)sulfanylpropanoylamino]-3-[(2R)-1-methoxypropan-2-yl]thiourea (PubChem CID 8637676) has the molecular formula C16H25N3O2S2 and a molecular weight of 355.53 g/mol. Its IUPAC name is 1-[3-(3,4-dimethylphenyl)sulfanylpropanoylamino]-3-[(2R)-1-methoxypropan-2-yl]thiourea.
| Compound Name | 1-[3-(3,4-dimethylphenyl)sulfanylpropanoylamino]-3-[(2R)-1-methoxypropan-2-yl]thiourea |
|---|---|
| PubChem CID | 8637676 |
| Molecular Formula | C16H25N3O2S2 |
| Molecular Weight | 355.53 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | 1-[3-(3,4-dimethylphenyl)sulfanylpropanoylamino]-3-[(2R)-1-methoxypropan-2-yl]thiourea |
| SMILES | COC[C@@H](C)NC(=S)NNC(=O)CCSc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C16H25N3O2S2/c1-11-5-6-14(9-12(11)2)23-8-7-15(20)18-19-16(22)17-13(3)10-21-4/h5-6,9,13H,7-8,10H2,1-4H3,(H,18,20)(H2,17,19,22)/t13-/m1/s1 |
| InChIKey | REXJLFNFTQZPFN-CYBMUJFWSA-N |
| XLogP | 2.32 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.53 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|