C16H25N3O3S — CID 9478344
1-[(2R)-1-methoxypropan-2-yl]-3-[4-(4-methylphenoxy)butanoylamino]thiourea (PubChem CID 9478344) has the molecular formula C16H25N3O3S and a molecular weight of 339.46 g/mol. Its IUPAC name is 1-[(2R)-1-methoxypropan-2-yl]-3-[4-(4-methylphenoxy)butanoylamino]thiourea.
| Compound Name | 1-[(2R)-1-methoxypropan-2-yl]-3-[4-(4-methylphenoxy)butanoylamino]thiourea |
|---|---|
| PubChem CID | 9478344 |
| Molecular Formula | C16H25N3O3S |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | 1-[(2R)-1-methoxypropan-2-yl]-3-[4-(4-methylphenoxy)butanoylamino]thiourea |
| SMILES | COC[C@@H](C)NC(=S)NNC(=O)CCCOc1ccc(C)cc1 |
| InChI | InChI=1S/C16H25N3O3S/c1-12-6-8-14(9-7-12)22-10-4-5-15(20)18-19-16(23)17-13(2)11-21-3/h6-9,13H,4-5,10-11H2,1-3H3,(H,18,20)(H2,17,19,23)/t13-/m1/s1 |
| InChIKey | JKICCKTZOFEDAY-CYBMUJFWSA-N |
| XLogP | 1.68 |
| TPSA | 71.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|