C16H24N4O4S2 — CID 9477823
N-(4-methoxyphenyl)-2-[2-[2-[[(2S)-1-methoxypropan-2-yl]carbamothioyl]hydrazinyl]-2-oxoethyl]sulfanylacetamide (PubChem CID 9477823) has the molecular formula C16H24N4O4S2 and a molecular weight of 400.53 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-2-[2-[2-[[(2S)-1-methoxypropan-2-yl]carbamothioyl]hydrazinyl]-2-oxoethyl]sulfanylacetamide.
| Compound Name | N-(4-methoxyphenyl)-2-[2-[2-[[(2S)-1-methoxypropan-2-yl]carbamothioyl]hydrazinyl]-2-oxoethyl]sulfanylacetamide |
|---|---|
| PubChem CID | 9477823 |
| Molecular Formula | C16H24N4O4S2 |
| Molecular Weight | 400.53 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | N-(4-methoxyphenyl)-2-[2-[2-[[(2S)-1-methoxypropan-2-yl]carbamothioyl]hydrazinyl]-2-oxoethyl]sulfanylacetamide |
| SMILES | COC[C@H](C)NC(=S)NNC(=O)CSCC(=O)Nc1ccc(OC)cc1 |
| InChI | InChI=1S/C16H24N4O4S2/c1-11(8-23-2)17-16(25)20-19-15(22)10-26-9-14(21)18-12-4-6-13(24-3)7-5-12/h4-7,11H,8-10H2,1-3H3,(H,18,21)(H,19,22)(H2,17,20,25)/t11-/m0/s1 |
| InChIKey | IHLLYRQWPFEGSC-NSHDSACASA-N |
| XLogP | 0.90 |
| TPSA | 100.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.53 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|