C15H21ClN4O3S2 — CID 9477833
N-(4-chlorophenyl)-2-[2-[2-[[(2R)-1-methoxypropan-2-yl]carbamothioyl]hydrazinyl]-2-oxoethyl]sulfanylacetamide (PubChem CID 9477833) has the molecular formula C15H21ClN4O3S2 and a molecular weight of 404.95 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-[2-[2-[[(2R)-1-methoxypropan-2-yl]carbamothioyl]hydrazinyl]-2-oxoethyl]sulfanylacetamide.
| Compound Name | N-(4-chlorophenyl)-2-[2-[2-[[(2R)-1-methoxypropan-2-yl]carbamothioyl]hydrazinyl]-2-oxoethyl]sulfanylacetamide |
|---|---|
| PubChem CID | 9477833 |
| Molecular Formula | C15H21ClN4O3S2 |
| Molecular Weight | 404.95 g/mol |
| Exact Mass | 404.07 |
| IUPAC Name | N-(4-chlorophenyl)-2-[2-[2-[[(2R)-1-methoxypropan-2-yl]carbamothioyl]hydrazinyl]-2-oxoethyl]sulfanylacetamide |
| SMILES | COC[C@@H](C)NC(=S)NNC(=O)CSCC(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H21ClN4O3S2/c1-10(7-23-2)17-15(24)20-19-14(22)9-25-8-13(21)18-12-5-3-11(16)4-6-12/h3-6,10H,7-9H2,1-2H3,(H,18,21)(H,19,22)(H2,17,20,24)/t10-/m1/s1 |
| InChIKey | UJKZPDQUUKRYTH-SNVBAGLBSA-N |
| XLogP | 1.54 |
| TPSA | 91.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.95 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|