C14H19Cl2N3O2S2 — CID 9477702
1-[[2-[(3,4-dichlorophenyl)methylsulfanyl]acetyl]amino]-3-[(2S)-1-methoxypropan-2-yl]thiourea (PubChem CID 9477702) has the molecular formula C14H19Cl2N3O2S2 and a molecular weight of 396.37 g/mol. Its IUPAC name is 1-[[2-[(3,4-dichlorophenyl)methylsulfanyl]acetyl]amino]-3-[(2S)-1-methoxypropan-2-yl]thiourea.
| Compound Name | 1-[[2-[(3,4-dichlorophenyl)methylsulfanyl]acetyl]amino]-3-[(2S)-1-methoxypropan-2-yl]thiourea |
|---|---|
| PubChem CID | 9477702 |
| Molecular Formula | C14H19Cl2N3O2S2 |
| Molecular Weight | 396.37 g/mol |
| Exact Mass | 395.03 |
| IUPAC Name | 1-[[2-[(3,4-dichlorophenyl)methylsulfanyl]acetyl]amino]-3-[(2S)-1-methoxypropan-2-yl]thiourea |
| SMILES | COC[C@H](C)NC(=S)NNC(=O)CSCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H19Cl2N3O2S2/c1-9(6-21-2)17-14(22)19-18-13(20)8-23-7-10-3-4-11(15)12(16)5-10/h3-5,9H,6-8H2,1-2H3,(H,18,20)(H2,17,19,22)/t9-/m0/s1 |
| InChIKey | VDAUKQKLIVBPIH-VIFPVBQESA-N |
| XLogP | 2.76 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.37 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|