C13H18N4O4S — CID 9478840
1-[(2R)-1-methoxypropan-2-yl]-3-[[2-(4-nitrophenyl)acetyl]amino]thiourea (PubChem CID 9478840) has the molecular formula C13H18N4O4S and a molecular weight of 326.38 g/mol. Its IUPAC name is 1-[(2R)-1-methoxypropan-2-yl]-3-[[2-(4-nitrophenyl)acetyl]amino]thiourea.
| Compound Name | 1-[(2R)-1-methoxypropan-2-yl]-3-[[2-(4-nitrophenyl)acetyl]amino]thiourea |
|---|---|
| PubChem CID | 9478840 |
| Molecular Formula | C13H18N4O4S |
| Molecular Weight | 326.38 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | 1-[(2R)-1-methoxypropan-2-yl]-3-[[2-(4-nitrophenyl)acetyl]amino]thiourea |
| SMILES | COC[C@@H](C)NC(=S)NNC(=O)Cc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C13H18N4O4S/c1-9(8-21-2)14-13(22)16-15-12(18)7-10-3-5-11(6-4-10)17(19)20/h3-6,9H,7-8H2,1-2H3,(H,15,18)(H2,14,16,22)/t9-/m1/s1 |
| InChIKey | ASDVOPIRWZGFGH-SECBINFHSA-N |
| XLogP | 0.67 |
| TPSA | 105.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.38 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|