C16H18N4O4S — CID 9176171
1-[(2R)-1-methoxypropan-2-yl]-3-[(Z)-[5-(4-nitrophenyl)furan-2-yl]methylideneamino]thiourea (PubChem CID 9176171) has the molecular formula C16H18N4O4S and a molecular weight of 362.41 g/mol. Its IUPAC name is 1-[(2R)-1-methoxypropan-2-yl]-3-[(Z)-[5-(4-nitrophenyl)furan-2-yl]methylideneamino]thiourea.
| Compound Name | 1-[(2R)-1-methoxypropan-2-yl]-3-[(Z)-[5-(4-nitrophenyl)furan-2-yl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 9176171 |
| Molecular Formula | C16H18N4O4S |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | 1-[(2R)-1-methoxypropan-2-yl]-3-[(Z)-[5-(4-nitrophenyl)furan-2-yl]methylideneamino]thiourea |
| SMILES | COC[C@@H](C)NC(=S)N/N=C\c1ccc(-c2ccc([N+](=O)[O-])cc2)o1 |
| InChI | InChI=1S/C16H18N4O4S/c1-11(10-23-2)18-16(25)19-17-9-14-7-8-15(24-14)12-3-5-13(6-4-12)20(21)22/h3-9,11H,10H2,1-2H3,(H2,18,19,25)/b17-9-/t11-/m1/s1 |
| InChIKey | IAYWMJDMCMMRAG-JWHLFPLYSA-N |
| XLogP | 2.69 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|