C18H19FN4O3S2 — CID 25104686
2-[2-[2-[(4-fluorophenyl)carbamothioyl]hydrazinyl]-2-oxoethyl]sulfanyl-N-(4-methoxyphenyl)acetamide (PubChem CID 25104686) has the molecular formula C18H19FN4O3S2 and a molecular weight of 422.51 g/mol. Its IUPAC name is 2-[2-[2-[(4-fluorophenyl)carbamothioyl]hydrazinyl]-2-oxoethyl]sulfanyl-N-(4-methoxyphenyl)acetamide.
| Compound Name | 2-[2-[2-[(4-fluorophenyl)carbamothioyl]hydrazinyl]-2-oxoethyl]sulfanyl-N-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 25104686 |
| Molecular Formula | C18H19FN4O3S2 |
| Molecular Weight | 422.51 g/mol |
| Exact Mass | 422.09 |
| IUPAC Name | 2-[2-[2-[(4-fluorophenyl)carbamothioyl]hydrazinyl]-2-oxoethyl]sulfanyl-N-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(NC(=O)CSCC(=O)NNC(=S)Nc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C18H19FN4O3S2/c1-26-15-8-6-13(7-9-15)20-16(24)10-28-11-17(25)22-23-18(27)21-14-4-2-12(19)3-5-14/h2-9H,10-11H2,1H3,(H,20,24)(H,22,25)(H2,21,23,27) |
| InChIKey | PZOCZFPQNFEXND-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 91.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.51 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|