C17H17ClN4O2S2 — CID 4096018
2-[2-[2-[(4-chlorophenyl)carbamothioyl]hydrazinyl]-2-oxoethyl]sulfanyl-N-phenylacetamide (PubChem CID 4096018) has the molecular formula C17H17ClN4O2S2 and a molecular weight of 408.94 g/mol. Its IUPAC name is 2-[2-[2-[(4-chlorophenyl)carbamothioyl]hydrazinyl]-2-oxoethyl]sulfanyl-N-phenylacetamide.
| Compound Name | 2-[2-[2-[(4-chlorophenyl)carbamothioyl]hydrazinyl]-2-oxoethyl]sulfanyl-N-phenylacetamide |
|---|---|
| PubChem CID | 4096018 |
| Molecular Formula | C17H17ClN4O2S2 |
| Molecular Weight | 408.94 g/mol |
| Exact Mass | 408.05 |
| IUPAC Name | 2-[2-[2-[(4-chlorophenyl)carbamothioyl]hydrazinyl]-2-oxoethyl]sulfanyl-N-phenylacetamide |
| SMILES | O=C(CSCC(=O)Nc1ccccc1)NNC(=S)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H17ClN4O2S2/c18-12-6-8-14(9-7-12)20-17(25)22-21-16(24)11-26-10-15(23)19-13-4-2-1-3-5-13/h1-9H,10-11H2,(H,19,23)(H,21,24)(H2,20,22,25) |
| InChIKey | IPJTTWKMYKZGHT-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.94 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|