C17H16Cl2N4O3S — CID 2822664
2-[2-[2-[(3,5-dichlorophenyl)carbamoyl]hydrazinyl]-2-oxoethyl]sulfanyl-N-phenylacetamide (PubChem CID 2822664) has the molecular formula C17H16Cl2N4O3S and a molecular weight of 427.31 g/mol. Its IUPAC name is 2-[2-[2-[(3,5-dichlorophenyl)carbamoyl]hydrazinyl]-2-oxoethyl]sulfanyl-N-phenylacetamide.
| Compound Name | 2-[2-[2-[(3,5-dichlorophenyl)carbamoyl]hydrazinyl]-2-oxoethyl]sulfanyl-N-phenylacetamide |
|---|---|
| PubChem CID | 2822664 |
| Molecular Formula | C17H16Cl2N4O3S |
| Molecular Weight | 427.31 g/mol |
| Exact Mass | 426.03 |
| IUPAC Name | 2-[2-[2-[(3,5-dichlorophenyl)carbamoyl]hydrazinyl]-2-oxoethyl]sulfanyl-N-phenylacetamide |
| SMILES | O=C(CSCC(=O)Nc1ccccc1)NNC(=O)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C17H16Cl2N4O3S/c18-11-6-12(19)8-14(7-11)21-17(26)23-22-16(25)10-27-9-15(24)20-13-4-2-1-3-5-13/h1-8H,9-10H2,(H,20,24)(H,22,25)(H2,21,23,26) |
| InChIKey | JLZIIEQAGKVYAN-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.31 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|