C10H10NO3S- — CID 5216476
2-(2-anilino-2-oxoethyl)sulfanylacetate (PubChem CID 5216476) has the molecular formula C10H10NO3S- and a molecular weight of 224.26 g/mol. Its IUPAC name is 2-(2-anilino-2-oxoethyl)sulfanylacetate.
| Compound Name | 2-(2-anilino-2-oxoethyl)sulfanylacetate |
|---|---|
| PubChem CID | 5216476 |
| Molecular Formula | C10H10NO3S- |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.04 |
| IUPAC Name | 2-(2-anilino-2-oxoethyl)sulfanylacetate |
| SMILES | O=C([O-])CSCC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C10H11NO3S/c12-9(6-15-7-10(13)14)11-8-4-2-1-3-5-8/h1-5H,6-7H2,(H,11,12)(H,13,14)/p-1 |
| InChIKey | ABHZTPDZBMDHPI-UHFFFAOYSA-M |
| XLogP | 0.11 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |