C16H14NO3S- — CID 5012492
4-[(2-anilino-2-oxoethyl)sulfanylmethyl]benzoate (PubChem CID 5012492) has the molecular formula C16H14NO3S- and a molecular weight of 300.36 g/mol. Its IUPAC name is 4-[(2-anilino-2-oxoethyl)sulfanylmethyl]benzoate.
| Compound Name | 4-[(2-anilino-2-oxoethyl)sulfanylmethyl]benzoate |
|---|---|
| PubChem CID | 5012492 |
| Molecular Formula | C16H14NO3S- |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | 4-[(2-anilino-2-oxoethyl)sulfanylmethyl]benzoate |
| SMILES | O=C(CSCc1ccc(C(=O)[O-])cc1)Nc1ccccc1 |
| InChI | InChI=1S/C16H15NO3S/c18-15(17-14-4-2-1-3-5-14)11-21-10-12-6-8-13(9-7-12)16(19)20/h1-9H,10-11H2,(H,17,18)(H,19,20)/p-1 |
| InChIKey | RAZJRNBQPZOQGU-UHFFFAOYSA-M |
| XLogP | 1.92 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |