C16H12Cl2NO3S- — CID 7309260
4-[[2-[(2,6-dichlorophenyl)methylsulfanyl]acetyl]amino]benzoate (PubChem CID 7309260) has the molecular formula C16H12Cl2NO3S- and a molecular weight of 369.25 g/mol. Its IUPAC name is 4-[[2-[(2,6-dichlorophenyl)methylsulfanyl]acetyl]amino]benzoate.
| Compound Name | 4-[[2-[(2,6-dichlorophenyl)methylsulfanyl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 7309260 |
| Molecular Formula | C16H12Cl2NO3S- |
| Molecular Weight | 369.25 g/mol |
| Exact Mass | 367.99 |
| IUPAC Name | 4-[[2-[(2,6-dichlorophenyl)methylsulfanyl]acetyl]amino]benzoate |
| SMILES | O=C(CSCc1c(Cl)cccc1Cl)Nc1ccc(C(=O)[O-])cc1 |
| InChI | InChI=1S/C16H13Cl2NO3S/c17-13-2-1-3-14(18)12(13)8-23-9-15(20)19-11-6-4-10(5-7-11)16(21)22/h1-7H,8-9H2,(H,19,20)(H,21,22)/p-1 |
| InChIKey | MXFXJFOXSPVTHA-UHFFFAOYSA-M |
| XLogP | 3.23 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.25 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |