C16H14Cl3NOS — CID 1193977
N-(4-methylphenyl)-2-[(2,3,6-trichlorophenyl)methylsulfanyl]acetamide (PubChem CID 1193977) has the molecular formula C16H14Cl3NOS and a molecular weight of 374.72 g/mol. Its IUPAC name is N-(4-methylphenyl)-2-[(2,3,6-trichlorophenyl)methylsulfanyl]acetamide.
| Compound Name | N-(4-methylphenyl)-2-[(2,3,6-trichlorophenyl)methylsulfanyl]acetamide |
|---|---|
| PubChem CID | 1193977 |
| Molecular Formula | C16H14Cl3NOS |
| Molecular Weight | 374.72 g/mol |
| Exact Mass | 372.99 |
| IUPAC Name | N-(4-methylphenyl)-2-[(2,3,6-trichlorophenyl)methylsulfanyl]acetamide |
| SMILES | Cc1ccc(NC(=O)CSCc2c(Cl)ccc(Cl)c2Cl)cc1 |
| InChI | InChI=1S/C16H14Cl3NOS/c1-10-2-4-11(5-3-10)20-15(21)9-22-8-12-13(17)6-7-14(18)16(12)19/h2-7H,8-9H2,1H3,(H,20,21) |
| InChIKey | XQCXWFVTYAJGJA-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.72 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|