C20H22Cl2N2OS — CID 100508961
2-[(2,6-dichlorophenyl)methylsulfanyl]-N-(4-piperidin-1-ylphenyl)acetamide (PubChem CID 100508961) has the molecular formula C20H22Cl2N2OS and a molecular weight of 409.38 g/mol. Its IUPAC name is 2-[(2,6-dichlorophenyl)methylsulfanyl]-N-(4-piperidin-1-ylphenyl)acetamide.
| Compound Name | 2-[(2,6-dichlorophenyl)methylsulfanyl]-N-(4-piperidin-1-ylphenyl)acetamide |
|---|---|
| PubChem CID | 100508961 |
| Molecular Formula | C20H22Cl2N2OS |
| Molecular Weight | 409.38 g/mol |
| Exact Mass | 408.08 |
| IUPAC Name | 2-[(2,6-dichlorophenyl)methylsulfanyl]-N-(4-piperidin-1-ylphenyl)acetamide |
| SMILES | O=C(CSCc1c(Cl)cccc1Cl)Nc1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C20H22Cl2N2OS/c21-18-5-4-6-19(22)17(18)13-26-14-20(25)23-15-7-9-16(10-8-15)24-11-2-1-3-12-24/h4-10H,1-3,11-14H2,(H,23,25) |
| InChIKey | RVBDCLAJSAMLFH-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.38 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|