C12H17NO3S — CID 79682862
2-(2,3-dihydroxypropylsulfanyl)-N-(4-methylphenyl)acetamide (PubChem CID 79682862) has the molecular formula C12H17NO3S and a molecular weight of 255.34 g/mol. Its IUPAC name is 2-(2,3-dihydroxypropylsulfanyl)-N-(4-methylphenyl)acetamide.
| Compound Name | 2-(2,3-dihydroxypropylsulfanyl)-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 79682862 |
| Molecular Formula | C12H17NO3S |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | 2-(2,3-dihydroxypropylsulfanyl)-N-(4-methylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)CSCC(O)CO)cc1 |
| InChI | InChI=1S/C12H17NO3S/c1-9-2-4-10(5-3-9)13-12(16)8-17-7-11(15)6-14/h2-5,11,14-15H,6-8H2,1H3,(H,13,16) |
| InChIKey | ACWBYBUJFWCVPN-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |