C21H24N2O4S — CID 7732145
propan-2-yl 4-[[2-[2-(4-methylanilino)-2-oxoethyl]sulfanylacetyl]amino]benzoate (PubChem CID 7732145) has the molecular formula C21H24N2O4S and a molecular weight of 400.50 g/mol. Its IUPAC name is propan-2-yl 4-[[2-[2-(4-methylanilino)-2-oxoethyl]sulfanylacetyl]amino]benzoate.
| Compound Name | propan-2-yl 4-[[2-[2-(4-methylanilino)-2-oxoethyl]sulfanylacetyl]amino]benzoate |
|---|---|
| PubChem CID | 7732145 |
| Molecular Formula | C21H24N2O4S |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | propan-2-yl 4-[[2-[2-(4-methylanilino)-2-oxoethyl]sulfanylacetyl]amino]benzoate |
| SMILES | Cc1ccc(NC(=O)CSCC(=O)Nc2ccc(C(=O)OC(C)C)cc2)cc1 |
| InChI | InChI=1S/C21H24N2O4S/c1-14(2)27-21(26)16-6-10-18(11-7-16)23-20(25)13-28-12-19(24)22-17-8-4-15(3)5-9-17/h4-11,14H,12-13H2,1-3H3,(H,22,24)(H,23,25) |
| InChIKey | CGDGINZACYMKII-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |