C16H21NO5S — CID 8604556
propan-2-yl 4-[[2-(2-ethoxy-2-oxoethyl)sulfanylacetyl]amino]benzoate (PubChem CID 8604556) has the molecular formula C16H21NO5S and a molecular weight of 339.41 g/mol. Its IUPAC name is propan-2-yl 4-[[2-(2-ethoxy-2-oxoethyl)sulfanylacetyl]amino]benzoate.
| Compound Name | propan-2-yl 4-[[2-(2-ethoxy-2-oxoethyl)sulfanylacetyl]amino]benzoate |
|---|---|
| PubChem CID | 8604556 |
| Molecular Formula | C16H21NO5S |
| Molecular Weight | 339.41 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | propan-2-yl 4-[[2-(2-ethoxy-2-oxoethyl)sulfanylacetyl]amino]benzoate |
| SMILES | CCOC(=O)CSCC(=O)Nc1ccc(C(=O)OC(C)C)cc1 |
| InChI | InChI=1S/C16H21NO5S/c1-4-21-15(19)10-23-9-14(18)17-13-7-5-12(6-8-13)16(20)22-11(2)3/h5-8,11H,4,9-10H2,1-3H3,(H,17,18) |
| InChIKey | PLAOIFKPQQYICQ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.41 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |