C14H16N2O3S — CID 43069113
propan-2-yl 4-[[2-(cyanomethylsulfanyl)acetyl]amino]benzoate (PubChem CID 43069113) has the molecular formula C14H16N2O3S and a molecular weight of 292.36 g/mol. Its IUPAC name is propan-2-yl 4-[[2-(cyanomethylsulfanyl)acetyl]amino]benzoate.
| Compound Name | propan-2-yl 4-[[2-(cyanomethylsulfanyl)acetyl]amino]benzoate |
|---|---|
| PubChem CID | 43069113 |
| Molecular Formula | C14H16N2O3S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | propan-2-yl 4-[[2-(cyanomethylsulfanyl)acetyl]amino]benzoate |
| SMILES | CC(C)OC(=O)c1ccc(NC(=O)CSCC#N)cc1 |
| InChI | InChI=1S/C14H16N2O3S/c1-10(2)19-14(18)11-3-5-12(6-4-11)16-13(17)9-20-8-7-15/h3-6,10H,8-9H2,1-2H3,(H,16,17) |
| InChIKey | KYZNZSFQAOBQKO-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|