C17H18N2O4S — CID 7795426
propan-2-yl 4-[[2-(1-oxidopyridin-1-ium-2-yl)sulfanylacetyl]amino]benzoate (PubChem CID 7795426) has the molecular formula C17H18N2O4S and a molecular weight of 346.41 g/mol. Its IUPAC name is propan-2-yl 4-[[2-(1-oxidopyridin-1-ium-2-yl)sulfanylacetyl]amino]benzoate.
| Compound Name | propan-2-yl 4-[[2-(1-oxidopyridin-1-ium-2-yl)sulfanylacetyl]amino]benzoate |
|---|---|
| PubChem CID | 7795426 |
| Molecular Formula | C17H18N2O4S |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | propan-2-yl 4-[[2-(1-oxidopyridin-1-ium-2-yl)sulfanylacetyl]amino]benzoate |
| SMILES | CC(C)OC(=O)c1ccc(NC(=O)CSc2cccc[n+]2[O-])cc1 |
| InChI | InChI=1S/C17H18N2O4S/c1-12(2)23-17(21)13-6-8-14(9-7-13)18-15(20)11-24-16-5-3-4-10-19(16)22/h3-10,12H,11H2,1-2H3,(H,18,20) |
| InChIKey | CJMIKGXQOGURQJ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 82.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|