C21H20N2O2S2 — CID 7795633
N-[4-(2,5-dimethylphenyl)sulfanylphenyl]-2-(1-oxidopyridin-1-ium-2-yl)sulfanylacetamide (PubChem CID 7795633) has the molecular formula C21H20N2O2S2 and a molecular weight of 396.54 g/mol. Its IUPAC name is N-[4-(2,5-dimethylphenyl)sulfanylphenyl]-2-(1-oxidopyridin-1-ium-2-yl)sulfanylacetamide.
| Compound Name | N-[4-(2,5-dimethylphenyl)sulfanylphenyl]-2-(1-oxidopyridin-1-ium-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 7795633 |
| Molecular Formula | C21H20N2O2S2 |
| Molecular Weight | 396.54 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | N-[4-(2,5-dimethylphenyl)sulfanylphenyl]-2-(1-oxidopyridin-1-ium-2-yl)sulfanylacetamide |
| SMILES | Cc1ccc(C)c(Sc2ccc(NC(=O)CSc3cccc[n+]3[O-])cc2)c1 |
| InChI | InChI=1S/C21H20N2O2S2/c1-15-6-7-16(2)19(13-15)27-18-10-8-17(9-11-18)22-20(24)14-26-21-5-3-4-12-23(21)25/h3-13H,14H2,1-2H3,(H,22,24) |
| InChIKey | IFHDPLUXJQYISV-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 56.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.54 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|