C11H11N3O3S — CID 47138005
N-(3-methyl-1,2-oxazol-5-yl)-2-(1-oxidopyridin-1-ium-2-yl)sulfanylacetamide (PubChem CID 47138005) has the molecular formula C11H11N3O3S and a molecular weight of 265.29 g/mol. Its IUPAC name is N-(3-methyl-1,2-oxazol-5-yl)-2-(1-oxidopyridin-1-ium-2-yl)sulfanylacetamide.
| Compound Name | N-(3-methyl-1,2-oxazol-5-yl)-2-(1-oxidopyridin-1-ium-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 47138005 |
| Molecular Formula | C11H11N3O3S |
| Molecular Weight | 265.29 g/mol |
| Exact Mass | 265.05 |
| IUPAC Name | N-(3-methyl-1,2-oxazol-5-yl)-2-(1-oxidopyridin-1-ium-2-yl)sulfanylacetamide |
| SMILES | Cc1cc(NC(=O)CSc2cccc[n+]2[O-])on1 |
| InChI | InChI=1S/C11H11N3O3S/c1-8-6-10(17-13-8)12-9(15)7-18-11-4-2-3-5-14(11)16/h2-6H,7H2,1H3,(H,12,15) |
| InChIKey | GKPGXGZZAQDBQS-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 82.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.29 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|