C17H19N3O5S2 — CID 7795624
N-(4-morpholin-4-ylsulfonylphenyl)-2-(1-oxidopyridin-1-ium-2-yl)sulfanylacetamide (PubChem CID 7795624) has the molecular formula C17H19N3O5S2 and a molecular weight of 409.49 g/mol. Its IUPAC name is N-(4-morpholin-4-ylsulfonylphenyl)-2-(1-oxidopyridin-1-ium-2-yl)sulfanylacetamide.
| Compound Name | N-(4-morpholin-4-ylsulfonylphenyl)-2-(1-oxidopyridin-1-ium-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 7795624 |
| Molecular Formula | C17H19N3O5S2 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.08 |
| IUPAC Name | N-(4-morpholin-4-ylsulfonylphenyl)-2-(1-oxidopyridin-1-ium-2-yl)sulfanylacetamide |
| SMILES | O=C(CSc1cccc[n+]1[O-])Nc1ccc(S(=O)(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C17H19N3O5S2/c21-16(13-26-17-3-1-2-8-20(17)22)18-14-4-6-15(7-5-14)27(23,24)19-9-11-25-12-10-19/h1-8H,9-13H2,(H,18,21) |
| InChIKey | ZTGFXFNTOKAIHM-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 102.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|