C18H18ClFN2O4S2 — CID 29479537
2-(3-chloro-4-fluorophenyl)sulfanyl-N-(4-morpholin-4-ylsulfonylphenyl)acetamide (PubChem CID 29479537) has the molecular formula C18H18ClFN2O4S2 and a molecular weight of 444.94 g/mol. Its IUPAC name is 2-(3-chloro-4-fluorophenyl)sulfanyl-N-(4-morpholin-4-ylsulfonylphenyl)acetamide.
| Compound Name | 2-(3-chloro-4-fluorophenyl)sulfanyl-N-(4-morpholin-4-ylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 29479537 |
| Molecular Formula | C18H18ClFN2O4S2 |
| Molecular Weight | 444.94 g/mol |
| Exact Mass | 444.04 |
| IUPAC Name | 2-(3-chloro-4-fluorophenyl)sulfanyl-N-(4-morpholin-4-ylsulfonylphenyl)acetamide |
| SMILES | O=C(CSc1ccc(F)c(Cl)c1)Nc1ccc(S(=O)(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C18H18ClFN2O4S2/c19-16-11-14(3-6-17(16)20)27-12-18(23)21-13-1-4-15(5-2-13)28(24,25)22-7-9-26-10-8-22/h1-6,11H,7-10,12H2,(H,21,23) |
| InChIKey | RQOKJNHMVCYSEI-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.94 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |