C18H19ClN2O4S2 — CID 3424032
2-(4-chlorophenyl)sulfanyl-N-(3-morpholin-4-ylsulfonylphenyl)acetamide (PubChem CID 3424032) has the molecular formula C18H19ClN2O4S2 and a molecular weight of 426.95 g/mol. Its IUPAC name is 2-(4-chlorophenyl)sulfanyl-N-(3-morpholin-4-ylsulfonylphenyl)acetamide.
| Compound Name | 2-(4-chlorophenyl)sulfanyl-N-(3-morpholin-4-ylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 3424032 |
| Molecular Formula | C18H19ClN2O4S2 |
| Molecular Weight | 426.95 g/mol |
| Exact Mass | 426.05 |
| IUPAC Name | 2-(4-chlorophenyl)sulfanyl-N-(3-morpholin-4-ylsulfonylphenyl)acetamide |
| SMILES | O=C(CSc1ccc(Cl)cc1)Nc1cccc(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C18H19ClN2O4S2/c19-14-4-6-16(7-5-14)26-13-18(22)20-15-2-1-3-17(12-15)27(23,24)21-8-10-25-11-9-21/h1-7,12H,8-11,13H2,(H,20,22) |
| InChIKey | PKVNUDSDFRPSKG-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.95 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |