C17H27N3O4S — CID 119671799
7-amino-N-(3-morpholin-4-ylsulfonylphenyl)heptanamide (PubChem CID 119671799) has the molecular formula C17H27N3O4S and a molecular weight of 369.49 g/mol. Its IUPAC name is 7-amino-N-(3-morpholin-4-ylsulfonylphenyl)heptanamide.
| Compound Name | 7-amino-N-(3-morpholin-4-ylsulfonylphenyl)heptanamide |
|---|---|
| PubChem CID | 119671799 |
| Molecular Formula | C17H27N3O4S |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | 7-amino-N-(3-morpholin-4-ylsulfonylphenyl)heptanamide |
| SMILES | NCCCCCCC(=O)Nc1cccc(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C17H27N3O4S/c18-9-4-2-1-3-8-17(21)19-15-6-5-7-16(14-15)25(22,23)20-10-12-24-13-11-20/h5-7,14H,1-4,8-13,18H2,(H,19,21) |
| InChIKey | SZZAHBSDFLZTQV-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|