C17H27ClN4O4S — CID 119713468
7-amino-N-[3-(3-oxopiperazin-1-yl)sulfonylphenyl]heptanamide;hydrochloride (PubChem CID 119713468) has the molecular formula C17H27ClN4O4S and a molecular weight of 418.95 g/mol. Its IUPAC name is 7-amino-N-[3-(3-oxopiperazin-1-yl)sulfonylphenyl]heptanamide;hydrochloride.
| Compound Name | 7-amino-N-[3-(3-oxopiperazin-1-yl)sulfonylphenyl]heptanamide;hydrochloride |
|---|---|
| PubChem CID | 119713468 |
| Molecular Formula | C17H27ClN4O4S |
| Molecular Weight | 418.95 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | 7-amino-N-[3-(3-oxopiperazin-1-yl)sulfonylphenyl]heptanamide;hydrochloride |
| SMILES | Cl.NCCCCCCC(=O)Nc1cccc(S(=O)(=O)N2CCNC(=O)C2)c1 |
| InChI | InChI=1S/C17H26N4O4S.ClH/c18-9-4-2-1-3-8-16(22)20-14-6-5-7-15(12-14)26(24,25)21-11-10-19-17(23)13-21;/h5-7,12H,1-4,8-11,13,18H2,(H,19,23)(H,20,22);1H |
| InChIKey | AYDUJCKWKGYXFO-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.95 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|