C15H23ClN4O5S — CID 119713498
2-(2-methoxyethylamino)-N-[3-(3-oxopiperazin-1-yl)sulfonylphenyl]acetamide;hydrochloride (PubChem CID 119713498) has the molecular formula C15H23ClN4O5S and a molecular weight of 406.89 g/mol. Its IUPAC name is 2-(2-methoxyethylamino)-N-[3-(3-oxopiperazin-1-yl)sulfonylphenyl]acetamide;hydrochloride.
| Compound Name | 2-(2-methoxyethylamino)-N-[3-(3-oxopiperazin-1-yl)sulfonylphenyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 119713498 |
| Molecular Formula | C15H23ClN4O5S |
| Molecular Weight | 406.89 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | 2-(2-methoxyethylamino)-N-[3-(3-oxopiperazin-1-yl)sulfonylphenyl]acetamide;hydrochloride |
| SMILES | COCCNCC(=O)Nc1cccc(S(=O)(=O)N2CCNC(=O)C2)c1.Cl |
| InChI | InChI=1S/C15H22N4O5S.ClH/c1-24-8-6-16-10-14(20)18-12-3-2-4-13(9-12)25(22,23)19-7-5-17-15(21)11-19;/h2-4,9,16H,5-8,10-11H2,1H3,(H,17,21)(H,18,20);1H |
| InChIKey | KNBQEHYDIVXDEG-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.89 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|