C20H18ClN5O4S — CID 55924131
1-(3-chlorophenyl)-N-[3-(3-oxopiperazin-1-yl)sulfonylphenyl]pyrazole-3-carboxamide (PubChem CID 55924131) has the molecular formula C20H18ClN5O4S and a molecular weight of 459.92 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-N-[3-(3-oxopiperazin-1-yl)sulfonylphenyl]pyrazole-3-carboxamide.
| Compound Name | 1-(3-chlorophenyl)-N-[3-(3-oxopiperazin-1-yl)sulfonylphenyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 55924131 |
| Molecular Formula | C20H18ClN5O4S |
| Molecular Weight | 459.92 g/mol |
| Exact Mass | 459.08 |
| IUPAC Name | 1-(3-chlorophenyl)-N-[3-(3-oxopiperazin-1-yl)sulfonylphenyl]pyrazole-3-carboxamide |
| SMILES | O=C1CN(S(=O)(=O)c2cccc(NC(=O)c3ccn(-c4cccc(Cl)c4)n3)c2)CCN1 |
| InChI | InChI=1S/C20H18ClN5O4S/c21-14-3-1-5-16(11-14)26-9-7-18(24-26)20(28)23-15-4-2-6-17(12-15)31(29,30)25-10-8-22-19(27)13-25/h1-7,9,11-12H,8,10,13H2,(H,22,27)(H,23,28) |
| InChIKey | GNQBGXGNIIFHLR-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 113.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.92 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |