C20H19N7O6S — CID 55762611
5-methyl-1-(3-nitrophenyl)-N-[3-(3-oxopiperazin-1-yl)sulfonylphenyl]triazole-4-carboxamide (PubChem CID 55762611) has the molecular formula C20H19N7O6S and a molecular weight of 485.48 g/mol. Its IUPAC name is 5-methyl-1-(3-nitrophenyl)-N-[3-(3-oxopiperazin-1-yl)sulfonylphenyl]triazole-4-carboxamide.
| Compound Name | 5-methyl-1-(3-nitrophenyl)-N-[3-(3-oxopiperazin-1-yl)sulfonylphenyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 55762611 |
| Molecular Formula | C20H19N7O6S |
| Molecular Weight | 485.48 g/mol |
| Exact Mass | 485.11 |
| IUPAC Name | 5-methyl-1-(3-nitrophenyl)-N-[3-(3-oxopiperazin-1-yl)sulfonylphenyl]triazole-4-carboxamide |
| SMILES | Cc1c(C(=O)Nc2cccc(S(=O)(=O)N3CCNC(=O)C3)c2)nnn1-c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H19N7O6S/c1-13-19(23-24-26(13)15-5-3-6-16(11-15)27(30)31)20(29)22-14-4-2-7-17(10-14)34(32,33)25-9-8-21-18(28)12-25/h2-7,10-11H,8-9,12H2,1H3,(H,21,28)(H,22,29) |
| InChIKey | LJSBUVQGBVPFBU-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 169.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.48 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|