C23H24N6O5S — CID 55516329
[4-(2,3-dihydro-1H-inden-5-ylsulfonyl)piperazin-1-yl]-[5-methyl-1-(3-nitrophenyl)triazol-4-yl]methanone (PubChem CID 55516329) has the molecular formula C23H24N6O5S and a molecular weight of 496.55 g/mol. Its IUPAC name is [4-(2,3-dihydro-1H-inden-5-ylsulfonyl)piperazin-1-yl]-[5-methyl-1-(3-nitrophenyl)triazol-4-yl]methanone.
| Compound Name | [4-(2,3-dihydro-1H-inden-5-ylsulfonyl)piperazin-1-yl]-[5-methyl-1-(3-nitrophenyl)triazol-4-yl]methanone |
|---|---|
| PubChem CID | 55516329 |
| Molecular Formula | C23H24N6O5S |
| Molecular Weight | 496.55 g/mol |
| Exact Mass | 496.15 |
| IUPAC Name | [4-(2,3-dihydro-1H-inden-5-ylsulfonyl)piperazin-1-yl]-[5-methyl-1-(3-nitrophenyl)triazol-4-yl]methanone |
| SMILES | Cc1c(C(=O)N2CCN(S(=O)(=O)c3ccc4c(c3)CCC4)CC2)nnn1-c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H24N6O5S/c1-16-22(24-25-28(16)19-6-3-7-20(15-19)29(31)32)23(30)26-10-12-27(13-11-26)35(33,34)21-9-8-17-4-2-5-18(17)14-21/h3,6-9,14-15H,2,4-5,10-13H2,1H3 |
| InChIKey | CXLCBBMHMGXUBA-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 131.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.55 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|