C17H20N6O3 — CID 119637985
3,9-diazabicyclo[4.2.1]nonan-3-yl-[5-methyl-1-(3-nitrophenyl)triazol-4-yl]methanone (PubChem CID 119637985) has the molecular formula C17H20N6O3 and a molecular weight of 356.39 g/mol. Its IUPAC name is 3,9-diazabicyclo[4.2.1]nonan-3-yl-[5-methyl-1-(3-nitrophenyl)triazol-4-yl]methanone.
| Compound Name | 3,9-diazabicyclo[4.2.1]nonan-3-yl-[5-methyl-1-(3-nitrophenyl)triazol-4-yl]methanone |
|---|---|
| PubChem CID | 119637985 |
| Molecular Formula | C17H20N6O3 |
| Molecular Weight | 356.39 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | 3,9-diazabicyclo[4.2.1]nonan-3-yl-[5-methyl-1-(3-nitrophenyl)triazol-4-yl]methanone |
| SMILES | Cc1c(C(=O)N2CCC3CCC(C2)N3)nnn1-c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H20N6O3/c1-11-16(17(24)21-8-7-12-5-6-13(10-21)18-12)19-20-22(11)14-3-2-4-15(9-14)23(25)26/h2-4,9,12-13,18H,5-8,10H2,1H3 |
| InChIKey | DNNRYBBPCWOWMI-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 106.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.39 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|