C19H23N7O5 — CID 55607637
2-[4-[5-methyl-1-(3-nitrophenyl)triazole-4-carbonyl]piperazin-1-yl]-2-oxo-N-propan-2-ylacetamide (PubChem CID 55607637) has the molecular formula C19H23N7O5 and a molecular weight of 429.44 g/mol. Its IUPAC name is 2-[4-[5-methyl-1-(3-nitrophenyl)triazole-4-carbonyl]piperazin-1-yl]-2-oxo-N-propan-2-ylacetamide.
| Compound Name | 2-[4-[5-methyl-1-(3-nitrophenyl)triazole-4-carbonyl]piperazin-1-yl]-2-oxo-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 55607637 |
| Molecular Formula | C19H23N7O5 |
| Molecular Weight | 429.44 g/mol |
| Exact Mass | 429.18 |
| IUPAC Name | 2-[4-[5-methyl-1-(3-nitrophenyl)triazole-4-carbonyl]piperazin-1-yl]-2-oxo-N-propan-2-ylacetamide |
| SMILES | Cc1c(C(=O)N2CCN(C(=O)C(=O)NC(C)C)CC2)nnn1-c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H23N7O5/c1-12(2)20-17(27)19(29)24-9-7-23(8-10-24)18(28)16-13(3)25(22-21-16)14-5-4-6-15(11-14)26(30)31/h4-6,11-12H,7-10H2,1-3H3,(H,20,27) |
| InChIKey | RVPXZMJDFIPBGB-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 143.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.44 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|