C14H17N5O3 — CID 134002140
N,N-diethyl-5-methyl-1-(3-nitrophenyl)triazole-4-carboxamide (PubChem CID 134002140) has the molecular formula C14H17N5O3 and a molecular weight of 303.32 g/mol. Its IUPAC name is N,N-diethyl-5-methyl-1-(3-nitrophenyl)triazole-4-carboxamide.
| Compound Name | N,N-diethyl-5-methyl-1-(3-nitrophenyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 134002140 |
| Molecular Formula | C14H17N5O3 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | N,N-diethyl-5-methyl-1-(3-nitrophenyl)triazole-4-carboxamide |
| SMILES | CCN(CC)C(=O)c1nnn(-c2cccc([N+](=O)[O-])c2)c1C |
| InChI | InChI=1S/C14H17N5O3/c1-4-17(5-2)14(20)13-10(3)18(16-15-13)11-7-6-8-12(9-11)19(21)22/h6-9H,4-5H2,1-3H3 |
| InChIKey | YRZZJZVNABTMJP-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 94.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|