C16H23ClN6O3 — CID 119642537
N-(2-amino-2-ethylbutyl)-5-methyl-1-(3-nitrophenyl)triazole-4-carboxamide;hydrochloride (PubChem CID 119642537) has the molecular formula C16H23ClN6O3 and a molecular weight of 382.85 g/mol. Its IUPAC name is N-(2-amino-2-ethylbutyl)-5-methyl-1-(3-nitrophenyl)triazole-4-carboxamide;hydrochloride.
| Compound Name | N-(2-amino-2-ethylbutyl)-5-methyl-1-(3-nitrophenyl)triazole-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119642537 |
| Molecular Formula | C16H23ClN6O3 |
| Molecular Weight | 382.85 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | N-(2-amino-2-ethylbutyl)-5-methyl-1-(3-nitrophenyl)triazole-4-carboxamide;hydrochloride |
| SMILES | CCC(N)(CC)CNC(=O)c1nnn(-c2cccc([N+](=O)[O-])c2)c1C.Cl |
| InChI | InChI=1S/C16H22N6O3.ClH/c1-4-16(17,5-2)10-18-15(23)14-11(3)21(20-19-14)12-7-6-8-13(9-12)22(24)25;/h6-9H,4-5,10,17H2,1-3H3,(H,18,23);1H |
| InChIKey | MVJWDUATSKMGJI-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 128.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.85 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|