C17H25ClN6O3 — CID 119599415
N-(1-amino-2,4-dimethylpentan-2-yl)-5-methyl-1-(3-nitrophenyl)triazole-4-carboxamide;hydrochloride (PubChem CID 119599415) has the molecular formula C17H25ClN6O3 and a molecular weight of 396.88 g/mol. Its IUPAC name is N-(1-amino-2,4-dimethylpentan-2-yl)-5-methyl-1-(3-nitrophenyl)triazole-4-carboxamide;hydrochloride.
| Compound Name | N-(1-amino-2,4-dimethylpentan-2-yl)-5-methyl-1-(3-nitrophenyl)triazole-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119599415 |
| Molecular Formula | C17H25ClN6O3 |
| Molecular Weight | 396.88 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | N-(1-amino-2,4-dimethylpentan-2-yl)-5-methyl-1-(3-nitrophenyl)triazole-4-carboxamide;hydrochloride |
| SMILES | Cc1c(C(=O)NC(C)(CN)CC(C)C)nnn1-c1cccc([N+](=O)[O-])c1.Cl |
| InChI | InChI=1S/C17H24N6O3.ClH/c1-11(2)9-17(4,10-18)19-16(24)15-12(3)22(21-20-15)13-6-5-7-14(8-13)23(25)26;/h5-8,11H,9-10,18H2,1-4H3,(H,19,24);1H |
| InChIKey | GHDGAXIWNMFJNL-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 128.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.88 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|