C21H22FN5O3 — CID 55783339
N-[1-(4-fluorophenyl)-2,2-dimethylpropyl]-5-methyl-1-(3-nitrophenyl)triazole-4-carboxamide (PubChem CID 55783339) has the molecular formula C21H22FN5O3 and a molecular weight of 411.44 g/mol. Its IUPAC name is N-[1-(4-fluorophenyl)-2,2-dimethylpropyl]-5-methyl-1-(3-nitrophenyl)triazole-4-carboxamide.
| Compound Name | N-[1-(4-fluorophenyl)-2,2-dimethylpropyl]-5-methyl-1-(3-nitrophenyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 55783339 |
| Molecular Formula | C21H22FN5O3 |
| Molecular Weight | 411.44 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | N-[1-(4-fluorophenyl)-2,2-dimethylpropyl]-5-methyl-1-(3-nitrophenyl)triazole-4-carboxamide |
| SMILES | Cc1c(C(=O)NC(c2ccc(F)cc2)C(C)(C)C)nnn1-c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H22FN5O3/c1-13-18(24-25-26(13)16-6-5-7-17(12-16)27(29)30)20(28)23-19(21(2,3)4)14-8-10-15(22)11-9-14/h5-12,19H,1-4H3,(H,23,28) |
| InChIKey | MOLUIMUGGBQGAZ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.44 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|