C22H24FN7O3 — CID 55657669
N-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]-5-methyl-1-(3-nitrophenyl)triazole-4-carboxamide (PubChem CID 55657669) has the molecular formula C22H24FN7O3 and a molecular weight of 453.48 g/mol. Its IUPAC name is N-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]-5-methyl-1-(3-nitrophenyl)triazole-4-carboxamide.
| Compound Name | N-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]-5-methyl-1-(3-nitrophenyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 55657669 |
| Molecular Formula | C22H24FN7O3 |
| Molecular Weight | 453.48 g/mol |
| Exact Mass | 453.19 |
| IUPAC Name | N-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]-5-methyl-1-(3-nitrophenyl)triazole-4-carboxamide |
| SMILES | Cc1c(C(=O)NCCN2CCN(c3ccc(F)cc3)CC2)nnn1-c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H24FN7O3/c1-16-21(25-26-29(16)19-3-2-4-20(15-19)30(32)33)22(31)24-9-10-27-11-13-28(14-12-27)18-7-5-17(23)6-8-18/h2-8,15H,9-14H2,1H3,(H,24,31) |
| InChIKey | SMJAUGWLCHVFGU-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 109.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.48 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|