C20H20N6O4 — CID 112809128
[4-(3-hydroxyphenyl)piperazin-1-yl]-[5-methyl-1-(3-nitrophenyl)triazol-4-yl]methanone (PubChem CID 112809128) has the molecular formula C20H20N6O4 and a molecular weight of 408.42 g/mol. Its IUPAC name is [4-(3-hydroxyphenyl)piperazin-1-yl]-[5-methyl-1-(3-nitrophenyl)triazol-4-yl]methanone.
| Compound Name | [4-(3-hydroxyphenyl)piperazin-1-yl]-[5-methyl-1-(3-nitrophenyl)triazol-4-yl]methanone |
|---|---|
| PubChem CID | 112809128 |
| Molecular Formula | C20H20N6O4 |
| Molecular Weight | 408.42 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | [4-(3-hydroxyphenyl)piperazin-1-yl]-[5-methyl-1-(3-nitrophenyl)triazol-4-yl]methanone |
| SMILES | Cc1c(C(=O)N2CCN(c3cccc(O)c3)CC2)nnn1-c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H20N6O4/c1-14-19(21-22-25(14)16-5-2-6-17(12-16)26(29)30)20(28)24-10-8-23(9-11-24)15-4-3-7-18(27)13-15/h2-7,12-13,27H,8-11H2,1H3 |
| InChIKey | OMEIPAVJLQPREW-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 117.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.42 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|