C20H19BrN6O3 — CID 55884201
[1-(3-bromophenyl)-5-methyltriazol-4-yl]-[4-(4-nitrophenyl)piperazin-1-yl]methanone (PubChem CID 55884201) has the molecular formula C20H19BrN6O3 and a molecular weight of 471.32 g/mol. Its IUPAC name is [1-(3-bromophenyl)-5-methyltriazol-4-yl]-[4-(4-nitrophenyl)piperazin-1-yl]methanone.
| Compound Name | [1-(3-bromophenyl)-5-methyltriazol-4-yl]-[4-(4-nitrophenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 55884201 |
| Molecular Formula | C20H19BrN6O3 |
| Molecular Weight | 471.32 g/mol |
| Exact Mass | 470.07 |
| IUPAC Name | [1-(3-bromophenyl)-5-methyltriazol-4-yl]-[4-(4-nitrophenyl)piperazin-1-yl]methanone |
| SMILES | Cc1c(C(=O)N2CCN(c3ccc([N+](=O)[O-])cc3)CC2)nnn1-c1cccc(Br)c1 |
| InChI | InChI=1S/C20H19BrN6O3/c1-14-19(22-23-26(14)18-4-2-3-15(21)13-18)20(28)25-11-9-24(10-12-25)16-5-7-17(8-6-16)27(29)30/h2-8,13H,9-12H2,1H3 |
| InChIKey | LBEUROWNXGMJTM-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 97.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.32 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|